|
Genipin is an aglycone derived from an iridoid glycoside called geniposide present in fruit of Gardenia jasmindides Ellis. Genipin is an excellent natural cross-linker for proteins, collagen, gelatin, and chitosan cross-linking. It has a low acute toxicity, with LD50 i.v. 382 mg/kg in mice, therefore, much less toxic than glutaraldehyde and many other commonly used synthetic cross-linking regents. It is also used for pharmaceutical purposes, such as choleretic action for liver diseases control. Genipin is available for small and large scale production.  Genipin Structure Buy Genipin ST080860 at eChemShop Product ID
| ST080860 | | IUPAC name | Methyl (1R,2R,6S)-2-hydroxy-9-(hydroxymethyl)- 3-oxabicyclo[4.3.0]nona-4,8-diene-5-carboxylate | | Identifiers | | CAS number | [6902-77-8] | | PubChem | 442424 | | SMILES | COC(=O)C1=CO[C@H]([C@H]2[C@@H]1CC=C2CO)O | | Properties | | Molecular formula | C11H14O5 | | Molar mass | 226.226 g/mol | Hydrogen Bonds Donors
| 2 | | Hydrogen Bonds Acceptors | 5 | Rotatable Bonds
| 3 | Polar Surface Area
| 76 | | XLogP | -0.8 | Exact Mass
| 226.084 | MonoIsotopic Mass
| 226.084 | Charge
| 0
| Complexity
| 35 |
Genipin Specification| | Specification | Results | | Appearance: | white crystal powder | | | Purity: | 98% up by HPLC method | 98.2% | | Solubilities: | soluble in Ethanol, Methanol, Acetone, slightly soluble in
water | | | Total plate count: | below 1000 CFU/g | 300 CFU/g | | E. coli: | Negative | Negative | | Salmonella: | Negative | Negative | | Storage: | Room temperature | | | | | |
Notice: It can be dissolved in Ethanol first, then diluted to suitable concentration with
buffer solution. |
